C25H28N2O4 — CID 67307252
(6R)-6-[5-(cyclohexen-1-yl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid (PubChem CID 67307252) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (6R)-6-[5-(cyclohexen-1-yl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid.
| Compound Name | (6R)-6-[5-(cyclohexen-1-yl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 67307252 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (6R)-6-[5-(cyclohexen-1-yl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
| SMILES | C[C@H](CCCCC(=O)O)Oc1ncnc2oc(-c3ccccc3)c(C3=CCCCC3)c12 |
| InChI | InChI=1S/C25H28N2O4/c1-17(10-8-9-15-20(28)29)30-24-22-21(18-11-4-2-5-12-18)23(19-13-6-3-7-14-19)31-25(22)27-16-26-24/h3,6-7,11,13-14,16-17H,2,4-5,8-10,12,15H2,1H3,(H,28,29)/t17-/m1/s1 |
| InChIKey | GXBICPSIWNHYSB-QGZVFWFLSA-N |
| XLogP | 6.26 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|