C25H28N2O5 — CID 68504013
(6R)-6-[5-(3-oxohex-1-enyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid (PubChem CID 68504013) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is (6R)-6-[5-(3-oxohex-1-enyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid.
| Compound Name | (6R)-6-[5-(3-oxohex-1-enyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 68504013 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (6R)-6-[5-(3-oxohex-1-enyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]oxyheptanoic acid |
| SMILES | CCCC(=O)C=Cc1c(-c2ccccc2)oc2ncnc(O[C@H](C)CCCCC(=O)O)c12 |
| InChI | InChI=1S/C25H28N2O5/c1-3-9-19(28)14-15-20-22-24(31-17(2)10-7-8-13-21(29)30)26-16-27-25(22)32-23(20)18-11-5-4-6-12-18/h4-6,11-12,14-17H,3,7-10,13H2,1-2H3,(H,29,30)/t17-/m1/s1 |
| InChIKey | RNEXHIRLSMRPBP-QGZVFWFLSA-N |
| XLogP | 5.68 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|