C30H30FN3O5 — CID 87292302
formyl 4-[(3R)-3-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxypiperidin-1-yl]butanoate (PubChem CID 87292302) has the molecular formula C30H30FN3O5 and a molecular weight of 531.58 g/mol. Its IUPAC name is formyl 4-[(3R)-3-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxypiperidin-1-yl]butanoate.
| Compound Name | formyl 4-[(3R)-3-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxypiperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 87292302 |
| Molecular Formula | C30H30FN3O5 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | formyl 4-[(3R)-3-[5-(4-ethylphenyl)-6-(2-fluorophenyl)furo[2,3-d]pyrimidin-4-yl]oxypiperidin-1-yl]butanoate |
| SMILES | CCc1ccc(-c2c(-c3ccccc3F)oc3ncnc(O[C@@H]4CCCN(CCCC(=O)OC=O)C4)c23)cc1 |
| InChI | InChI=1S/C30H30FN3O5/c1-2-20-11-13-21(14-12-20)26-27-29(32-18-33-30(27)39-28(26)23-8-3-4-9-24(23)31)38-22-7-5-15-34(17-22)16-6-10-25(36)37-19-35/h3-4,8-9,11-14,18-19,22H,2,5-7,10,15-17H2,1H3/t22-/m1/s1 |
| InChIKey | XNTSPZUWVVISSG-JOCHJYFZSA-N |
| XLogP | 5.58 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|