C29H32N4O3 — CID 89049958
5-[3-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-1-en-2-ol (PubChem CID 89049958) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 5-[3-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-1-en-2-ol.
| Compound Name | 5-[3-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-1-en-2-ol |
|---|---|
| PubChem CID | 89049958 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 5-[3-[[5-(4-methoxyphenyl)-6-phenylfuro[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-1-en-2-ol |
| SMILES | C=C(O)CCCN1CCCC(Nc2ncnc3oc(-c4ccccc4)c(-c4ccc(OC)cc4)c23)C1 |
| InChI | InChI=1S/C29H32N4O3/c1-20(34)8-6-16-33-17-7-11-23(18-33)32-28-26-25(21-12-14-24(35-2)15-13-21)27(22-9-4-3-5-10-22)36-29(26)31-19-30-28/h3-5,9-10,12-15,19,23,34H,1,6-8,11,16-18H2,2H3,(H,30,31,32) |
| InChIKey | UCAZSZJFLHHDPQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|