About (3-tert-butylphenyl) 1-fluoroethyl carbonate
(3-tert-butylphenyl) 1-fluoroethyl carbonate (PubChem CID 67160680) has the molecular formula C13H17FO3
and a molecular weight of 240.27 g/mol. Its IUPAC name is (3-tert-butylphenyl) 1-fluoroethyl carbonate.
Molecular Properties
| Compound Name | (3-tert-butylphenyl) 1-fluoroethyl carbonate |
| PubChem CID | 67160680 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (3-tert-butylphenyl) 1-fluoroethyl carbonate |
| SMILES | CC(F)OC(=O)Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C13H17FO3/c1-9(14)16-12(15)17-11-7-5-6-10(8-11)13(2,3)4/h5-9H,1-4H3 |
| InChIKey | CSGVRSZNVXPUPX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butylphenyl) 1-fluoroethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butylphenyl) 1-fluoroethyl carbonate?
The IUPAC name of (3-tert-butylphenyl) 1-fluoroethyl carbonate (CID 67160680) is (3-tert-butylphenyl) 1-fluoroethyl carbonate.
What is the SMILES notation for (3-tert-butylphenyl) 1-fluoroethyl carbonate?
The canonical SMILES for (3-tert-butylphenyl) 1-fluoroethyl carbonate is CC(F)OC(=O)Oc1cccc(C(C)(C)C)c1.
What is the InChIKey of (3-tert-butylphenyl) 1-fluoroethyl carbonate?
The InChIKey is CSGVRSZNVXPUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO3/c1-9(14)16-12(15)17-11-7-5-6-10(8-11)13(2,3)4/h5-9H,1-4H3.
What are the key properties of (3-tert-butylphenyl) 1-fluoroethyl carbonate?
(3-tert-butylphenyl) 1-fluoroethyl carbonate has a molecular weight of 240.27 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butylphenyl) 1-fluoroethyl carbonate is sourced from PubChem (CID 67160680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).