About (3-methoxyphenyl) 3-methylbutan-2-yl carbonate
(3-methoxyphenyl) 3-methylbutan-2-yl carbonate (PubChem CID 123755926) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is (3-methoxyphenyl) 3-methylbutan-2-yl carbonate.
Molecular Properties
| Compound Name | (3-methoxyphenyl) 3-methylbutan-2-yl carbonate |
| PubChem CID | 123755926 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3-methoxyphenyl) 3-methylbutan-2-yl carbonate |
| SMILES | COc1cccc(OC(=O)OC(C)C(C)C)c1 |
| InChI | InChI=1S/C13H18O4/c1-9(2)10(3)16-13(14)17-12-7-5-6-11(8-12)15-4/h5-10H,1-4H3 |
| InChIKey | HCDYZQXVECQSSF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl) 3-methylbutan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl) 3-methylbutan-2-yl carbonate?
The IUPAC name of (3-methoxyphenyl) 3-methylbutan-2-yl carbonate (CID 123755926) is (3-methoxyphenyl) 3-methylbutan-2-yl carbonate.
What is the SMILES notation for (3-methoxyphenyl) 3-methylbutan-2-yl carbonate?
The canonical SMILES for (3-methoxyphenyl) 3-methylbutan-2-yl carbonate is COc1cccc(OC(=O)OC(C)C(C)C)c1.
What is the InChIKey of (3-methoxyphenyl) 3-methylbutan-2-yl carbonate?
The InChIKey is HCDYZQXVECQSSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-9(2)10(3)16-13(14)17-12-7-5-6-11(8-12)15-4/h5-10H,1-4H3.
What are the key properties of (3-methoxyphenyl) 3-methylbutan-2-yl carbonate?
(3-methoxyphenyl) 3-methylbutan-2-yl carbonate has a molecular weight of 238.28 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl) 3-methylbutan-2-yl carbonate is sourced from PubChem (CID 123755926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).