C22H31N3O3 — CID 67165239
8-[2-(3-methoxyphenyl)acetyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67165239) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 8-[2-(3-methoxyphenyl)acetyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-[2-(3-methoxyphenyl)acetyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67165239 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 8-[2-(3-methoxyphenyl)acetyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(C(=O)Cc1cccc(OC)c1)CC2 |
| InChI | InChI=1S/C22H31N3O3/c1-5-11-25-21(27)20(16(2)3)23-22(25)9-12-24(13-10-22)19(26)15-17-7-6-8-18(14-17)28-4/h5-8,14,16,20,23H,1,9-13,15H2,2-4H3 |
| InChIKey | DPHGSGJVUAFVMM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|