C20H29N3O3S — CID 42823717
8-(4-methylphenyl)sulfonyl-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 42823717) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 8-(4-methylphenyl)sulfonyl-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-(4-methylphenyl)sulfonyl-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 42823717 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 8-(4-methylphenyl)sulfonyl-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(S(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C20H29N3O3S/c1-5-12-23-19(24)18(15(2)3)21-20(23)10-13-22(14-11-20)27(25,26)17-8-6-16(4)7-9-17/h5-9,15,18,21H,1,10-14H2,2-4H3 |
| InChIKey | FXXVNHHAAWUIEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|