C22H28N4O3S — CID 83280048
2-propan-2-yl-4-prop-2-enyl-8-quinolin-8-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 83280048) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-propan-2-yl-4-prop-2-enyl-8-quinolin-8-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2-propan-2-yl-4-prop-2-enyl-8-quinolin-8-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 83280048 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-propan-2-yl-4-prop-2-enyl-8-quinolin-8-ylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(S(=O)(=O)c1cccc3cccnc13)CC2 |
| InChI | InChI=1S/C22H28N4O3S/c1-4-13-26-21(27)19(16(2)3)24-22(26)10-14-25(15-11-22)30(28,29)18-9-5-7-17-8-6-12-23-20(17)18/h4-9,12,16,19,24H,1,10-11,13-15H2,2-3H3 |
| InChIKey | DFNGNJQCTROCKA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|