C25H24ClN3O4 — CID 67165287
2-[[2-[[2-(benzhydrylamino)-2-oxoethyl]-methylamino]acetyl]amino]-5-chlorobenzoic acid (PubChem CID 67165287) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-[[2-[[2-(benzhydrylamino)-2-oxoethyl]-methylamino]acetyl]amino]-5-chlorobenzoic acid.
| Compound Name | 2-[[2-[[2-(benzhydrylamino)-2-oxoethyl]-methylamino]acetyl]amino]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 67165287 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[[2-[[2-(benzhydrylamino)-2-oxoethyl]-methylamino]acetyl]amino]-5-chlorobenzoic acid |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cc1C(=O)O)CC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24ClN3O4/c1-29(15-22(30)27-21-13-12-19(26)14-20(21)25(32)33)16-23(31)28-24(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-14,24H,15-16H2,1H3,(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | HELKHIZKWNSCML-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |