C21H26ClNO3 — CID 67166001
tert-butyl N-[(2-chlorophenyl)methyl]-N-[[3-(2-hydroxyethyl)phenyl]methyl]carbamate (PubChem CID 67166001) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is tert-butyl N-[(2-chlorophenyl)methyl]-N-[[3-(2-hydroxyethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[(2-chlorophenyl)methyl]-N-[[3-(2-hydroxyethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67166001 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | tert-butyl N-[(2-chlorophenyl)methyl]-N-[[3-(2-hydroxyethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccc(CCO)c1)Cc1ccccc1Cl |
| InChI | InChI=1S/C21H26ClNO3/c1-21(2,3)26-20(25)23(15-18-9-4-5-10-19(18)22)14-17-8-6-7-16(13-17)11-12-24/h4-10,13,24H,11-12,14-15H2,1-3H3 |
| InChIKey | VSARRBHQNLFJKB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |