C18H18F3N3O2S — CID 67167560
(2R,6R)-8-[4-(trifluoromethyl)phenyl]sulfonyl-4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene (PubChem CID 67167560) has the molecular formula C18H18F3N3O2S and a molecular weight of 397.42 g/mol. Its IUPAC name is (2R,6R)-8-[4-(trifluoromethyl)phenyl]sulfonyl-4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene.
| Compound Name | (2R,6R)-8-[4-(trifluoromethyl)phenyl]sulfonyl-4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene |
|---|---|
| PubChem CID | 67167560 |
| Molecular Formula | C18H18F3N3O2S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2R,6R)-8-[4-(trifluoromethyl)phenyl]sulfonyl-4,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1Cc2cccnc2[C@H]2CNC[C@@H]2C1 |
| InChI | InChI=1S/C18H18F3N3O2S/c19-18(20,21)14-3-5-15(6-4-14)27(25,26)24-10-12-2-1-7-23-17(12)16-9-22-8-13(16)11-24/h1-7,13,16,22H,8-11H2/t13-,16+/m1/s1 |
| InChIKey | NKOVNPUHCXJRFU-CJNGLKHVSA-N |
| XLogP | 2.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |