C18H18F3N3O3S — CID 44611961
(3-methyl-2-pyridinyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 44611961) has the molecular formula C18H18F3N3O3S and a molecular weight of 413.42 g/mol. Its IUPAC name is (3-methyl-2-pyridinyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-methyl-2-pyridinyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 44611961 |
| Molecular Formula | C18H18F3N3O3S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (3-methyl-2-pyridinyl)-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cccnc1C(=O)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H18F3N3O3S/c1-13-3-2-8-22-16(13)17(25)23-9-11-24(12-10-23)28(26,27)15-6-4-14(5-7-15)18(19,20)21/h2-8H,9-12H2,1H3 |
| InChIKey | MNCORDODJXFOSM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |