C20H21NO2 — CID 67168299
1-[3-[(3aR,10bS)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrol-7-yl]phenyl]ethanone (PubChem CID 67168299) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[3-[(3aR,10bS)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrol-7-yl]phenyl]ethanone.
| Compound Name | 1-[3-[(3aR,10bS)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrol-7-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 67168299 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[3-[(3aR,10bS)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrol-7-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2cccc3c2OCC[C@H]2CNC[C@H]32)c1 |
| InChI | InChI=1S/C20H21NO2/c1-13(22)14-4-2-5-15(10-14)17-6-3-7-18-19-12-21-11-16(19)8-9-23-20(17)18/h2-7,10,16,19,21H,8-9,11-12H2,1H3/t16-,19-/m0/s1 |
| InChIKey | NZHJLIVTZDUXEO-LPHOPBHVSA-N |
| XLogP | 3.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |