C29H32N4O4 — CID 67169057
tert-butyl (2S)-2-[[[4-(4-methoxyphenoxy)pyrimidin-5-yl]-(2-phenylethynyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 67169057) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[4-(4-methoxyphenoxy)pyrimidin-5-yl]-(2-phenylethynyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[[4-(4-methoxyphenoxy)pyrimidin-5-yl]-(2-phenylethynyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67169057 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | tert-butyl (2S)-2-[[[4-(4-methoxyphenoxy)pyrimidin-5-yl]-(2-phenylethynyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(Oc2ncncc2N(C#Cc2ccccc2)C[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-29(2,3)37-28(34)33-17-8-11-23(33)20-32(18-16-22-9-6-5-7-10-22)26-19-30-21-31-27(26)36-25-14-12-24(35-4)13-15-25/h5-7,9-10,12-15,19,21,23H,8,11,17,20H2,1-4H3/t23-/m0/s1 |
| InChIKey | FFCQQLDSZZXCMF-QHCPKHFHSA-N |
| XLogP | 5.49 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|