C8H10O9S2 — CID 67173462
[2-(2-hydroxyethyl)-4-sulfooxyphenyl] hydrogen sulfate (PubChem CID 67173462) has the molecular formula C8H10O9S2 and a molecular weight of 314.29 g/mol. Its IUPAC name is [2-(2-hydroxyethyl)-4-sulfooxyphenyl] hydrogen sulfate.
| Compound Name | [2-(2-hydroxyethyl)-4-sulfooxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 67173462 |
| Molecular Formula | C8H10O9S2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | [2-(2-hydroxyethyl)-4-sulfooxyphenyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1ccc(OS(=O)(=O)O)c(CCO)c1 |
| InChI | InChI=1S/C8H10O9S2/c9-4-3-6-5-7(16-18(10,11)12)1-2-8(6)17-19(13,14)15/h1-2,5,9H,3-4H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | HHIHFKKHIXOKGJ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|