C17H18N4 — CID 67174564
2-methyl-4-phenyl-6-pyrrolidin-2-yl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 67174564) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6-pyrrolidin-2-yl-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 2-methyl-4-phenyl-6-pyrrolidin-2-yl-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 67174564 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-methyl-4-phenyl-6-pyrrolidin-2-yl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(-c2ccccc2)c2[nH]c(C3CCCN3)cc2n1 |
| InChI | InChI=1S/C17H18N4/c1-11-19-15-10-14(13-8-5-9-18-13)21-17(15)16(20-11)12-6-3-2-4-7-12/h2-4,6-7,10,13,18,21H,5,8-9H2,1H3 |
| InChIKey | JIJIHEGMFUVHCV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |