C18H15F4NO4 — CID 67175101
3-[[4-fluoro-2-(trifluoromethyl)phenoxy]methyl-(2-oxopropyl)amino]benzoic acid (PubChem CID 67175101) has the molecular formula C18H15F4NO4 and a molecular weight of 385.31 g/mol. Its IUPAC name is 3-[[4-fluoro-2-(trifluoromethyl)phenoxy]methyl-(2-oxopropyl)amino]benzoic acid.
| Compound Name | 3-[[4-fluoro-2-(trifluoromethyl)phenoxy]methyl-(2-oxopropyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67175101 |
| Molecular Formula | C18H15F4NO4 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3-[[4-fluoro-2-(trifluoromethyl)phenoxy]methyl-(2-oxopropyl)amino]benzoic acid |
| SMILES | CC(=O)CN(COc1ccc(F)cc1C(F)(F)F)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H15F4NO4/c1-11(24)9-23(14-4-2-3-12(7-14)17(25)26)10-27-16-6-5-13(19)8-15(16)18(20,21)22/h2-8H,9-10H2,1H3,(H,25,26) |
| InChIKey | HZJUYEDQAKYFHB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|