C9H15F2N — CID 67175459
(3S,4R)-1-cyclopentyl-3,4-difluoropyrrolidine (PubChem CID 67175459) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is (3S,4R)-1-cyclopentyl-3,4-difluoropyrrolidine.
| Compound Name | (3S,4R)-1-cyclopentyl-3,4-difluoropyrrolidine |
|---|---|
| PubChem CID | 67175459 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (3S,4R)-1-cyclopentyl-3,4-difluoropyrrolidine |
| SMILES | F[C@@H]1CN(C2CCCC2)C[C@@H]1F |
| InChI | InChI=1S/C9H15F2N/c10-8-5-12(6-9(8)11)7-3-1-2-4-7/h7-9H,1-6H2/t8-,9+ |
| InChIKey | VMCQXOPSZLYBOQ-DTORHVGOSA-N |
| XLogP | 1.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |