C23H18F3N3O2S — CID 67175649
[3-phenylsulfanyl-5-[[3-(trifluoromethyl)anilino]methyl]-1H-indol-2-yl] carbamate (PubChem CID 67175649) has the molecular formula C23H18F3N3O2S and a molecular weight of 457.48 g/mol. Its IUPAC name is [3-phenylsulfanyl-5-[[3-(trifluoromethyl)anilino]methyl]-1H-indol-2-yl] carbamate.
| Compound Name | [3-phenylsulfanyl-5-[[3-(trifluoromethyl)anilino]methyl]-1H-indol-2-yl] carbamate |
|---|---|
| PubChem CID | 67175649 |
| Molecular Formula | C23H18F3N3O2S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [3-phenylsulfanyl-5-[[3-(trifluoromethyl)anilino]methyl]-1H-indol-2-yl] carbamate |
| SMILES | NC(=O)Oc1[nH]c2ccc(CNc3cccc(C(F)(F)F)c3)cc2c1Sc1ccccc1 |
| InChI | InChI=1S/C23H18F3N3O2S/c24-23(25,26)15-5-4-6-16(12-15)28-13-14-9-10-19-18(11-14)20(21(29-19)31-22(27)30)32-17-7-2-1-3-8-17/h1-12,28-29H,13H2,(H2,27,30) |
| InChIKey | PWSMXIXGUUMSEZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |