C24H23N3O3S — CID 67174571
[6-[[(2-methoxyphenyl)methylamino]methyl]-3-phenylsulfanyl-1H-indol-2-yl] carbamate (PubChem CID 67174571) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is [6-[[(2-methoxyphenyl)methylamino]methyl]-3-phenylsulfanyl-1H-indol-2-yl] carbamate.
| Compound Name | [6-[[(2-methoxyphenyl)methylamino]methyl]-3-phenylsulfanyl-1H-indol-2-yl] carbamate |
|---|---|
| PubChem CID | 67174571 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [6-[[(2-methoxyphenyl)methylamino]methyl]-3-phenylsulfanyl-1H-indol-2-yl] carbamate |
| SMILES | COc1ccccc1CNCc1ccc2c(Sc3ccccc3)c(OC(N)=O)[nH]c2c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-29-21-10-6-5-7-17(21)15-26-14-16-11-12-19-20(13-16)27-23(30-24(25)28)22(19)31-18-8-3-2-4-9-18/h2-13,26-27H,14-15H2,1H3,(H2,25,28) |
| InChIKey | TWHGAXAECIMSIA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |