C12H18ClNO2 — CID 67179417
(5S)-2-amino-5-(4-chlorophenyl)-5-methoxypentan-1-ol (PubChem CID 67179417) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is (5S)-2-amino-5-(4-chlorophenyl)-5-methoxypentan-1-ol.
| Compound Name | (5S)-2-amino-5-(4-chlorophenyl)-5-methoxypentan-1-ol |
|---|---|
| PubChem CID | 67179417 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (5S)-2-amino-5-(4-chlorophenyl)-5-methoxypentan-1-ol |
| SMILES | CO[C@@H](CCC(N)CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2/c1-16-12(7-6-11(14)8-15)9-2-4-10(13)5-3-9/h2-5,11-12,15H,6-8,14H2,1H3/t11?,12-/m0/s1 |
| InChIKey | AHWMCAMJXFULMV-KIYNQFGBSA-N |
| XLogP | 2.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |