About 2-(1-phenoxybutyl)phenol
2-(1-phenoxybutyl)phenol (PubChem CID 67180489) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-(1-phenoxybutyl)phenol.
Molecular Properties
| Compound Name | 2-(1-phenoxybutyl)phenol |
| PubChem CID | 67180489 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(1-phenoxybutyl)phenol |
| SMILES | CCCC(Oc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C16H18O2/c1-2-8-16(14-11-6-7-12-15(14)17)18-13-9-4-3-5-10-13/h3-7,9-12,16-17H,2,8H2,1H3 |
| InChIKey | ZZHLMSQRTGURRD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-phenoxybutyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenoxybutyl)phenol?
The IUPAC name of 2-(1-phenoxybutyl)phenol (CID 67180489) is 2-(1-phenoxybutyl)phenol.
What is the SMILES notation for 2-(1-phenoxybutyl)phenol?
The canonical SMILES for 2-(1-phenoxybutyl)phenol is CCCC(Oc1ccccc1)c1ccccc1O.
What is the InChIKey of 2-(1-phenoxybutyl)phenol?
The InChIKey is ZZHLMSQRTGURRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-2-8-16(14-11-6-7-12-15(14)17)18-13-9-4-3-5-10-13/h3-7,9-12,16-17H,2,8H2,1H3.
What are the key properties of 2-(1-phenoxybutyl)phenol?
2-(1-phenoxybutyl)phenol has a molecular weight of 242.32 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenoxybutyl)phenol is sourced from PubChem (CID 67180489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).