C29H40N8O6 — CID 67181919
1-methyl-4-[[1-(3-methylbutyl)-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide (PubChem CID 67181919) has the molecular formula C29H40N8O6 and a molecular weight of 596.69 g/mol. Its IUPAC name is 1-methyl-4-[[1-(3-methylbutyl)-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[[1-(3-methylbutyl)-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 67181919 |
| Molecular Formula | C29H40N8O6 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 1-methyl-4-[[1-(3-methylbutyl)-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide |
| SMILES | CC(C)CCn1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cc1C(=O)Nc1cc(C(=O)NCCCN2CCOCC2)n(C)c1 |
| InChI | InChI=1S/C29H40N8O6/c1-20(2)6-9-36-18-22(32-28(39)25-16-23(37(41)42)19-34(25)4)15-26(36)29(40)31-21-14-24(33(3)17-21)27(38)30-7-5-8-35-10-12-43-13-11-35/h14-20H,5-13H2,1-4H3,(H,30,38)(H,31,40)(H,32,39) |
| InChIKey | PIVNAOZGCXIULN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 157.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|