C27H37N7O5S — CID 67184466
N-[3-(dimethylamino)propyl]-1-methyl-4-[[1-(3-methylbutyl)-4-[(2-methyl-5-nitrothiophene-3-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide (PubChem CID 67184466) has the molecular formula C27H37N7O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-methyl-4-[[1-(3-methylbutyl)-4-[(2-methyl-5-nitrothiophene-3-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-methyl-4-[[1-(3-methylbutyl)-4-[(2-methyl-5-nitrothiophene-3-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 67184466 |
| Molecular Formula | C27H37N7O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-methyl-4-[[1-(3-methylbutyl)-4-[(2-methyl-5-nitrothiophene-3-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxamide |
| SMILES | Cc1sc([N+](=O)[O-])cc1C(=O)Nc1cc(C(=O)Nc2cc(C(=O)NCCCN(C)C)n(C)c2)n(CCC(C)C)c1 |
| InChI | InChI=1S/C27H37N7O5S/c1-17(2)8-11-33-16-20(29-25(35)21-14-24(34(38)39)40-18(21)3)13-23(33)27(37)30-19-12-22(32(6)15-19)26(36)28-9-7-10-31(4)5/h12-17H,7-11H2,1-6H3,(H,28,36)(H,29,35)(H,30,37) |
| InChIKey | ZCKSKJHHQAPUCK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|