C40H60N10O4 — CID 22056418
1-N,4-N-bis[5-[(5-amino-5-iminopentyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]-2,5-dimethylbenzene-1,4-dicarboxamide (PubChem CID 22056418) has the molecular formula C40H60N10O4 and a molecular weight of 744.99 g/mol. Its IUPAC name is 1-N,4-N-bis[5-[(5-amino-5-iminopentyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]-2,5-dimethylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[5-[(5-amino-5-iminopentyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]-2,5-dimethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 22056418 |
| Molecular Formula | C40H60N10O4 |
| Molecular Weight | 744.99 g/mol |
| Exact Mass | 744.48 |
| IUPAC Name | 1-N,4-N-bis[5-[(5-amino-5-iminopentyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]-2,5-dimethylbenzene-1,4-dicarboxamide |
| SMILES | [H]/N=C(\N)CCCCNC(=O)c1cc(NC(=O)c2cc(C)c(C(=O)Nc3cc(C(=O)NCCCC/C(N)=N/[H])n(CCC(C)C)c3)cc2C)cn1CCC(C)C |
| InChI | InChI=1S/C40H60N10O4/c1-25(2)13-17-49-23-29(21-33(49)39(53)45-15-9-7-11-35(41)42)47-37(51)31-19-28(6)32(20-27(31)5)38(52)48-30-22-34(50(24-30)18-14-26(3)4)40(54)46-16-10-8-12-36(43)44/h19-26H,7-18H2,1-6H3,(H3,41,42)(H3,43,44)(H,45,53)(H,46,54)(H,47,51)(H,48,52) |
| InChIKey | WHDBVYOUOHTHAX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 226.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.99 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|