C8H16N2 — CID 67182409
1-ethyl-2,3-dimethyl-2,4-dihydropyrimidine (PubChem CID 67182409) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-2,4-dihydropyrimidine.
| Compound Name | 1-ethyl-2,3-dimethyl-2,4-dihydropyrimidine |
|---|---|
| PubChem CID | 67182409 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-2,4-dihydropyrimidine |
| SMILES | CCN1C=CCN(C)C1C |
| InChI | InChI=1S/C8H16N2/c1-4-10-7-5-6-9(3)8(10)2/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | XOGMMIWMBYTXCX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |