C23H27F3N2O — CID 67184561
3-[(1S,5R)-8-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]phenol (PubChem CID 67184561) has the molecular formula C23H27F3N2O and a molecular weight of 404.48 g/mol. Its IUPAC name is 3-[(1S,5R)-8-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]phenol.
| Compound Name | 3-[(1S,5R)-8-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]phenol |
|---|---|
| PubChem CID | 67184561 |
| Molecular Formula | C23H27F3N2O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-[(1S,5R)-8-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]phenol |
| SMILES | Oc1cccc(C2C[C@H]3CC[C@@H](C2)N3CCNCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H27F3N2O/c24-23(25,26)19-6-4-16(5-7-19)15-27-10-11-28-20-8-9-21(28)13-18(12-20)17-2-1-3-22(29)14-17/h1-7,14,18,20-21,27,29H,8-13,15H2/t18?,20-,21+ |
| InChIKey | UNNJZNPSAHWPFP-VCSGRIEYSA-N |
| XLogP | 4.91 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|