C19H23N3O5 — CID 67185938
tert-butyl (2S)-2-[(2-carbamoyl-1-benzofuran-3-yl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 67185938) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-carbamoyl-1-benzofuran-3-yl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2-carbamoyl-1-benzofuran-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67185938 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl (2S)-2-[(2-carbamoyl-1-benzofuran-3-yl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)Nc1c(C(N)=O)oc2ccccc12 |
| InChI | InChI=1S/C19H23N3O5/c1-19(2,3)27-18(25)22-10-6-8-12(22)17(24)21-14-11-7-4-5-9-13(11)26-15(14)16(20)23/h4-5,7,9,12H,6,8,10H2,1-3H3,(H2,20,23)(H,21,24)/t12-/m0/s1 |
| InChIKey | ZJAGNGJZKJNAAA-LBPRGKRZSA-N |
| XLogP | 2.87 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |