C21H25N — CID 67188279
5-tert-butyl-N-(1-phenylethyl)-2,3-dihydroinden-1-imine (PubChem CID 67188279) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-tert-butyl-N-(1-phenylethyl)-2,3-dihydroinden-1-imine.
| Compound Name | 5-tert-butyl-N-(1-phenylethyl)-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 67188279 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 5-tert-butyl-N-(1-phenylethyl)-2,3-dihydroinden-1-imine |
| SMILES | CC(/N=C1\CCc2cc(C(C)(C)C)ccc21)c1ccccc1 |
| InChI | InChI=1S/C21H25N/c1-15(16-8-6-5-7-9-16)22-20-13-10-17-14-18(21(2,3)4)11-12-19(17)20/h5-9,11-12,14-15H,10,13H2,1-4H3/b22-20+ |
| InChIKey | MMWMJWGDMHSRIO-LSDHQDQOSA-N |
| XLogP | 5.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|