C18H28N2O2 — CID 67189068
[(2S,3R)-3-amino-4-cyclohexyl-5-phenylpentan-2-yl]carbamic acid (PubChem CID 67189068) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(2S,3R)-3-amino-4-cyclohexyl-5-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-3-amino-4-cyclohexyl-5-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67189068 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [(2S,3R)-3-amino-4-cyclohexyl-5-phenylpentan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)[C@H](N)C(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13(20-18(21)22)17(19)16(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15-17,20H,3,6-7,10-12,19H2,1H3,(H,21,22)/t13-,16?,17-/m0/s1 |
| InChIKey | ZEIXJEHDAWJUHT-KAKCIXEOSA-N |
| XLogP | 3.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |