C12H15O6P — CID 67195781
(1-phenyl-3-phosphonooxypropan-2-yl) prop-2-enoate (PubChem CID 67195781) has the molecular formula C12H15O6P and a molecular weight of 286.22 g/mol. Its IUPAC name is (1-phenyl-3-phosphonooxypropan-2-yl) prop-2-enoate.
| Compound Name | (1-phenyl-3-phosphonooxypropan-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 67195781 |
| Molecular Formula | C12H15O6P |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (1-phenyl-3-phosphonooxypropan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(COP(=O)(O)O)Cc1ccccc1 |
| InChI | InChI=1S/C12H15O6P/c1-2-12(13)18-11(9-17-19(14,15)16)8-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2,(H2,14,15,16) |
| InChIKey | DLHVVVNZHGLIMA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|