C20H22Cl2N2O3S — CID 67196178
4-chloro-N-[[4-(chloromethyl)phenyl]methyl]-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide (PubChem CID 67196178) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is 4-chloro-N-[[4-(chloromethyl)phenyl]methyl]-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[4-(chloromethyl)phenyl]methyl]-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67196178 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-chloro-N-[[4-(chloromethyl)phenyl]methyl]-N-[(3R)-2-oxoazepan-3-yl]benzenesulfonamide |
| SMILES | O=C1NCCCC[C@H]1N(Cc1ccc(CCl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c21-13-15-4-6-16(7-5-15)14-24(19-3-1-2-12-23-20(19)25)28(26,27)18-10-8-17(22)9-11-18/h4-11,19H,1-3,12-14H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | QSLLBHMTKZJAMK-LJQANCHMSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|