C23H27ClN2O5S — CID 69489407
methyl 3-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]propanoate (PubChem CID 69489407) has the molecular formula C23H27ClN2O5S and a molecular weight of 479.00 g/mol. Its IUPAC name is methyl 3-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 69489407 |
| Molecular Formula | C23H27ClN2O5S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 3-[4-[[(4-chlorophenyl)sulfonyl-(2-oxoazepan-3-yl)amino]methyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(CN(C2CCCCNC2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H27ClN2O5S/c1-31-22(27)14-9-17-5-7-18(8-6-17)16-26(21-4-2-3-15-25-23(21)28)32(29,30)20-12-10-19(24)11-13-20/h5-8,10-13,21H,2-4,9,14-16H2,1H3,(H,25,28) |
| InChIKey | FIGMKRYYPUBHLZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |