C21H23ClN2O5S — CID 69491012
2-[4-[[(4-chlorophenyl)sulfonyl-[(3R)-2-oxoazepan-3-yl]amino]methyl]phenyl]acetic acid (PubChem CID 69491012) has the molecular formula C21H23ClN2O5S and a molecular weight of 450.94 g/mol. Its IUPAC name is 2-[4-[[(4-chlorophenyl)sulfonyl-[(3R)-2-oxoazepan-3-yl]amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(4-chlorophenyl)sulfonyl-[(3R)-2-oxoazepan-3-yl]amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 69491012 |
| Molecular Formula | C21H23ClN2O5S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[4-[[(4-chlorophenyl)sulfonyl-[(3R)-2-oxoazepan-3-yl]amino]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CN([C@@H]2CCCCNC2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H23ClN2O5S/c22-17-8-10-18(11-9-17)30(28,29)24(19-3-1-2-12-23-21(19)27)14-16-6-4-15(5-7-16)13-20(25)26/h4-11,19H,1-3,12-14H2,(H,23,27)(H,25,26)/t19-/m1/s1 |
| InChIKey | ZVYGOFQGPCAYTI-LJQANCHMSA-N |
| XLogP | 2.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |