C25H25F4N5O2S — CID 67199200
2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl]-N-(pyridazin-3-ylmethyl)ethanesulfonamide (PubChem CID 67199200) has the molecular formula C25H25F4N5O2S and a molecular weight of 535.57 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl]-N-(pyridazin-3-ylmethyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl]-N-(pyridazin-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 67199200 |
| Molecular Formula | C25H25F4N5O2S |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl]-N-(pyridazin-3-ylmethyl)ethanesulfonamide |
| SMILES | C[C@H]1C2=CNN(c3ccc(F)cc3)C2=CC2=C1[C@@H](CN(Cc1cccnn1)S(=O)(=O)CC(F)(F)F)CC2 |
| InChI | InChI=1S/C25H25F4N5O2S/c1-16-22-12-31-34(21-8-6-19(26)7-9-21)23(22)11-17-4-5-18(24(16)17)13-33(14-20-3-2-10-30-32-20)37(35,36)15-25(27,28)29/h2-3,6-12,16,18,31H,4-5,13-15H2,1H3/t16-,18+/m0/s1 |
| InChIKey | GRYLTTWGYHORML-FUHWJXTLSA-N |
| XLogP | 4.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |