C35H37FN4O — CID 68793523
1-benzyl-1-ethyl-3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]urea (PubChem CID 68793523) has the molecular formula C35H37FN4O and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-benzyl-1-ethyl-3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]urea.
| Compound Name | 1-benzyl-1-ethyl-3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]urea |
|---|---|
| PubChem CID | 68793523 |
| Molecular Formula | C35H37FN4O |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 1-benzyl-1-ethyl-3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]urea |
| SMILES | CCN(Cc1ccccc1)C(=O)NC(C[C@H]1CCC2=C1[C@@H](C)C1=CNN(c3ccc(F)cc3)C1=C2)c1ccccc1 |
| InChI | InChI=1S/C35H37FN4O/c1-3-39(23-25-10-6-4-7-11-25)35(41)38-32(26-12-8-5-9-13-26)20-27-14-15-28-21-33-31(24(2)34(27)28)22-37-40(33)30-18-16-29(36)17-19-30/h4-13,16-19,21-22,24,27,32,37H,3,14-15,20,23H2,1-2H3,(H,38,41)/t24-,27+,32?/m0/s1 |
| InChIKey | FPZYQXRQCAPLIX-SRSQPOCJSA-N |
| XLogP | 7.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |