C31H36FN3O — CID 68790007
N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,3-dimethylbutanamide (PubChem CID 68790007) has the molecular formula C31H36FN3O and a molecular weight of 485.65 g/mol. Its IUPAC name is N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 68790007 |
| Molecular Formula | C31H36FN3O |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,3-dimethylbutanamide |
| SMILES | C[C@H]1C2=CNN(c3ccc(F)cc3)C2=CC2=C1[C@@H](CC(NC(=O)CC(C)(C)C)c1ccccc1)CC2 |
| InChI | InChI=1S/C31H36FN3O/c1-20-26-19-33-35(25-14-12-24(32)13-15-25)28(26)17-23-11-10-22(30(20)23)16-27(21-8-6-5-7-9-21)34-29(36)18-31(2,3)4/h5-9,12-15,17,19-20,22,27,33H,10-11,16,18H2,1-4H3,(H,34,36)/t20-,22+,27?/m0/s1 |
| InChIKey | WBSDNYNGEPBODZ-VYEWMXHSSA-N |
| XLogP | 6.96 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |