C34H35FN4O2 — CID 68789760
1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 68789760) has the molecular formula C34H35FN4O2 and a molecular weight of 550.68 g/mol. Its IUPAC name is 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 68789760 |
| Molecular Formula | C34H35FN4O2 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 1-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC(C[C@H]2CCC3=C2[C@@H](C)C2=CNN(c4ccc(F)cc4)C2=C3)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H35FN4O2/c1-22-30-21-37-39(28-14-12-27(35)13-15-28)32(30)19-26-11-10-25(33(22)26)18-31(24-6-4-3-5-7-24)38-34(40)36-20-23-8-16-29(41-2)17-9-23/h3-9,12-17,19,21-22,25,31,37H,10-11,18,20H2,1-2H3,(H2,36,38,40)/t22-,25+,31?/m0/s1 |
| InChIKey | VFDVOVHOHOXYQS-IYAZVJMJSA-N |
| XLogP | 6.91 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |