C30H31F4N3O4S — CID 67199207
methyl 2-[2-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]ethyl]benzoate (PubChem CID 67199207) has the molecular formula C30H31F4N3O4S and a molecular weight of 605.65 g/mol. Its IUPAC name is methyl 2-[2-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]ethyl]benzoate.
| Compound Name | methyl 2-[2-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]ethyl]benzoate |
|---|---|
| PubChem CID | 67199207 |
| Molecular Formula | C30H31F4N3O4S |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | methyl 2-[2-[[(4R,5S)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]methyl-(2,2,2-trifluoroethylsulfonyl)amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CCN(C[C@H]1CCC2=C1[C@@H](C)C1=CNN(c3ccc(F)cc3)C1=C2)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C30H31F4N3O4S/c1-19-26-16-35-37(24-11-9-23(31)10-12-24)27(26)15-21-7-8-22(28(19)21)17-36(42(39,40)18-30(32,33)34)14-13-20-5-3-4-6-25(20)29(38)41-2/h3-6,9-12,15-16,19,22,35H,7-8,13-14,17-18H2,1-2H3/t19-,22+/m0/s1 |
| InChIKey | ROTIUXITWIFTRX-SIKLNZKXSA-N |
| XLogP | 5.50 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |