C33H39FN4O — CID 68790456
N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 68790456) has the molecular formula C33H39FN4O and a molecular weight of 526.70 g/mol. Its IUPAC name is N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 68790456 |
| Molecular Formula | C33H39FN4O |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-4,5,6,7-tetrahydro-2H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)NC(C[C@H]2CCC3=C2[C@@H](C)C2=CNN(c4ccc(F)cc4)C2=C3)c2ccccc2)C1 |
| InChI | InChI=1S/C33H39FN4O/c1-21-15-22(2)20-37(19-21)33(39)36-30(24-7-5-4-6-8-24)16-25-9-10-26-17-31-29(23(3)32(25)26)18-35-38(31)28-13-11-27(34)12-14-28/h4-8,11-14,17-18,21-23,25,30,35H,9-10,15-16,19-20H2,1-3H3,(H,36,39)/t21?,22?,23-,25+,30?/m0/s1 |
| InChIKey | SJLFLHPFPLBZGA-YIYPYFTKSA-N |
| XLogP | 7.09 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |