C21H30O5 — CID 67201658
1-[(9R,10S,13S,14R,17S)-1,1,2,2-tetrahydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 67201658) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[(9R,10S,13S,14R,17S)-1,1,2,2-tetrahydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(9R,10S,13S,14R,17S)-1,1,2,2-tetrahydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 67201658 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[(9R,10S,13S,14R,17S)-1,1,2,2-tetrahydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2C3=CC=C4CCC(O)(O)C(O)(O)[C@@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C21H30O5/c1-12(22)15-6-7-16-14-5-4-13-8-11-20(23,24)21(25,26)19(13,3)17(14)9-10-18(15,16)2/h4-5,15-17,23-26H,6-11H2,1-3H3/t15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | VNKUSBCIIPWRDC-RHQZKXFESA-N |
| XLogP | 2.05 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|