C21H30O3 — CID 69492343
1-[(9S,10R,13S,14R,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 69492343) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(9S,10R,13S,14R,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(9S,10R,13S,14R,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 69492343 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-[(9S,10R,13S,14R,17S)-1,1-dihydroxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2C3=CC=C4CCCC(O)(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H30O3/c1-13(22)16-8-9-17-15-7-6-14-5-4-11-21(23,24)20(14,3)18(15)10-12-19(16,17)2/h6-7,16-18,23-24H,4-5,8-12H2,1-3H3/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | DCCVAAXPEJSPIM-CXQPBAHBSA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|