C32H50O6 — CID 67934154
[(9S,10R,13R,14R,17R)-1-acetyloxy-17-[(2S)-6-hydroxy-3-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 67934154) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is [(9S,10R,13R,14R,17R)-1-acetyloxy-17-[(2S)-6-hydroxy-3-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(9S,10R,13R,14R,17R)-1-acetyloxy-17-[(2S)-6-hydroxy-3-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 67934154 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | [(9S,10R,13R,14R,17R)-1-acetyloxy-17-[(2S)-6-hydroxy-3-methoxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | COC(CCC(C)(C)O)[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4CCCC(OC(C)=O)(OC(C)=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H50O6/c1-20(28(36-8)16-18-29(4,5)35)25-13-14-26-24-12-11-23-10-9-17-32(37-21(2)33,38-22(3)34)31(23,7)27(24)15-19-30(25,26)6/h11-12,20,25-28,35H,9-10,13-19H2,1-8H3/t20-,25+,26-,27-,28?,30+,31-/m0/s1 |
| InChIKey | LFGUUOHRHTVKDP-ABLTWAKWSA-N |
| XLogP | 6.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|