C31H50O6 — CID 57062612
[(2S)-2-[(3R,8S,9S,10R,13S,14S,17R)-3-acetyloxy-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-hydroxy-6-methylheptan-3-yl] acetate (PubChem CID 57062612) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is [(2S)-2-[(3R,8S,9S,10R,13S,14S,17R)-3-acetyloxy-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-hydroxy-6-methylheptan-3-yl] acetate.
| Compound Name | [(2S)-2-[(3R,8S,9S,10R,13S,14S,17R)-3-acetyloxy-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-hydroxy-6-methylheptan-3-yl] acetate |
|---|---|
| PubChem CID | 57062612 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | [(2S)-2-[(3R,8S,9S,10R,13S,14S,17R)-3-acetyloxy-3-hydroxy-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-6-hydroxy-6-methylheptan-3-yl] acetate |
| SMILES | CC(=O)OC(CCC(C)(C)O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](O)(OC(C)=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H50O6/c1-19(27(36-20(2)32)13-14-28(4,5)34)24-10-11-25-23-9-8-22-18-31(35,37-21(3)33)17-16-29(22,6)26(23)12-15-30(24,25)7/h8,19,23-27,34-35H,9-18H2,1-7H3/t19-,23-,24+,25-,26-,27?,29-,30+,31+/m0/s1 |
| InChIKey | URUYCSCGZBTIOB-MBWIRSAJSA-N |
| XLogP | 5.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|