C26H29F3N4O3S — CID 67204854
N-[4-(butylsulfamoyl)phenyl]-3-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]benzamide (PubChem CID 67204854) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-3-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]benzamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-3-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 67204854 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-3-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]benzamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NC(=O)c2cccc(Cn3nc(C(F)(F)F)c4c3CCCC4)c2)cc1 |
| InChI | InChI=1S/C26H29F3N4O3S/c1-2-3-15-30-37(35,36)21-13-11-20(12-14-21)31-25(34)19-8-6-7-18(16-19)17-33-23-10-5-4-9-22(23)24(32-33)26(27,28)29/h6-8,11-14,16,30H,2-5,9-10,15,17H2,1H3,(H,31,34) |
| InChIKey | PCPFLUKBZITMMI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|