C30H28N2O3 — CID 67207100
tert-butyl-[1-[4-(7-cyano-3-phenyl-1-benzofuran-2-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 67207100) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is tert-butyl-[1-[4-(7-cyano-3-phenyl-1-benzofuran-2-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-(7-cyano-3-phenyl-1-benzofuran-2-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67207100 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | tert-butyl-[1-[4-(7-cyano-3-phenyl-1-benzofuran-2-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(-c3oc4c(C#N)cccc4c3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C30H28N2O3/c1-29(2,3)32(28(33)34)30(17-8-18-30)23-15-13-21(14-16-23)27-25(20-9-5-4-6-10-20)24-12-7-11-22(19-31)26(24)35-27/h4-7,9-16H,8,17-18H2,1-3H3,(H,33,34) |
| InChIKey | KESJPJSJCLSPAU-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |