C23H21F3N4O4 — CID 67208311
6-(2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]pyrimidin-5-yl]-5-fluoropyridine-2-carboxamide (PubChem CID 67208311) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]pyrimidin-5-yl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]pyrimidin-5-yl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 67208311 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 6-(2,6-difluorophenyl)-N-[4-[(2R,4R,5S,6R)-6-ethyl-4,5-dihydroxyoxan-2-yl]pyrimidin-5-yl]-5-fluoropyridine-2-carboxamide |
| SMILES | CC[C@H]1O[C@@H](c2ncncc2NC(=O)c2ccc(F)c(-c3c(F)cccc3F)n2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H21F3N4O4/c1-2-17-22(32)16(31)8-18(34-17)21-15(9-27-10-28-21)30-23(33)14-7-6-13(26)20(29-14)19-11(24)4-3-5-12(19)25/h3-7,9-10,16-18,22,31-32H,2,8H2,1H3,(H,30,33)/t16-,17-,18-,22+/m1/s1 |
| InChIKey | XKHMYCKXMPMEGJ-IDVKNYFZSA-N |
| XLogP | 3.17 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |