C24H29NO4S — CID 67208717
3-(2-cyclohexyl-6-oxopiperidin-1-yl)-5-(4-ethoxyphenyl)thiophene-2-carboxylic acid (PubChem CID 67208717) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-(2-cyclohexyl-6-oxopiperidin-1-yl)-5-(4-ethoxyphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(2-cyclohexyl-6-oxopiperidin-1-yl)-5-(4-ethoxyphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67208717 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 3-(2-cyclohexyl-6-oxopiperidin-1-yl)-5-(4-ethoxyphenyl)thiophene-2-carboxylic acid |
| SMILES | CCOc1ccc(-c2cc(N3C(=O)CCCC3C3CCCCC3)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C24H29NO4S/c1-2-29-18-13-11-17(12-14-18)21-15-20(23(30-21)24(27)28)25-19(9-6-10-22(25)26)16-7-4-3-5-8-16/h11-16,19H,2-10H2,1H3,(H,27,28) |
| InChIKey | VOEJVXFCXJYIEJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |