C26H32N2O3S2 — CID 87310425
3-(2-cyclohexyl-4-cyclopentylsulfanyl-6-oxopiperazin-1-yl)-5-phenylthiophene-2-carboxylic acid (PubChem CID 87310425) has the molecular formula C26H32N2O3S2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 3-(2-cyclohexyl-4-cyclopentylsulfanyl-6-oxopiperazin-1-yl)-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-(2-cyclohexyl-4-cyclopentylsulfanyl-6-oxopiperazin-1-yl)-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 87310425 |
| Molecular Formula | C26H32N2O3S2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-(2-cyclohexyl-4-cyclopentylsulfanyl-6-oxopiperazin-1-yl)-5-phenylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2ccccc2)cc1N1C(=O)CN(SC2CCCC2)CC1C1CCCCC1 |
| InChI | InChI=1S/C26H32N2O3S2/c29-24-17-27(33-20-13-7-8-14-20)16-22(18-9-3-1-4-10-18)28(24)21-15-23(32-25(21)26(30)31)19-11-5-2-6-12-19/h2,5-6,11-12,15,18,20,22H,1,3-4,7-10,13-14,16-17H2,(H,30,31) |
| InChIKey | RTTIRBYWYUAMSF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|